Compound Q&A

What industries use (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2)?

Answer

(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid
(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid is primarily used in the pharmaceutical industry for drug development. It also finds applications in the polymer industry for functionalization purposes and in the semiconductor industry for specific chemical processes.

About

CAS No 85999-40-2
English Name (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid
Molecular Formula C30H48O4
Molecular Weight 472.7100000000003 g/mol
SMILES CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H]([C@@]([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)CO)O)C)C(=O)O
InChIKey HXWLKAXCQLXHML-WGOZWDAUSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2)?

(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid has a crystalline form with a molecular weight of ap...

Compound Q&A

How is (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2) typically synthesized?

(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid is typically synthesized via the hydrogenation of lu...

Compound Q&A

What precautions should be taken when handling (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2)?

When handling (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid, it is essential to wear appropriate p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...