Compound Q&A

What are the physical and chemical properties of (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2)?

Answer

(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid
(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid has a crystalline form with a molecular weight of approximately 476.55 Da. It has moderate solubility in common organic solvents like methanol and ethanol. The compound exhibits hydrolytic and oxidative reactivity, particularly when exposed to air and light.

About

CAS No 85999-40-2
English Name (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid
Molecular Formula C30H48O4
Molecular Weight 472.7100000000003 g/mol
SMILES CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H]([C@@]([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)CO)O)C)C(=O)O
InChIKey HXWLKAXCQLXHML-WGOZWDAUSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2) typically synthesized?

(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid is typically synthesized via the hydrogenation of lu...

Compound Q&A

What industries use (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2)?

(3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid (CAS: 85999-40-2)?

When handling (3beta)-3,23-Dihydroxylup-20(29)-en-28-oic acid, it is essential to wear appropriate p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...