Compound Q&A

What are the physical and chemical properties of Dichlorophene (CAS: 97-23-4)?

Answer

Dichlorophene
Dichlorophene (CAS: 97-23-4) is a crystalline compound with a molecular weight of approximately 164.01 g/mol. It has a low solubility in water but is soluble in common organic solvents. Chemically, it is reactive towards nucleophiles and can participate in substitution reactions. Dichlorophene is stable under normal conditions but should be stored in a cool, dark place to prevent photochemical degradation.

About

CAS No 97-23-4
English Name Dichlorophene
Molecular Formula C13H10Cl2O2
Molecular Weight 269.13 g/mol
SMILES C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O
InChIKey MDNWOSOZYLHTCG-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Dichlorophene (CAS: 97-23-4) typically synthesized?

Dichlorophene (CAS: 97-23-4) is synthesized through the chlorination of phenol. Commonly, this invol...

Compound Q&A

What industries use Dichlorophene (CAS: 97-23-4)?

Dichlorophene (CAS: 97-23-4) is primarily used in the pharmaceutical industry for the synthesis of i...

Compound Q&A

What precautions should be taken when handling Dichlorophene (CAS: 97-23-4)?

When handling Dichlorophene (CAS: 97-23-4), it is crucial to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...