Compound Q&A

What are the physical and chemical properties of N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-1)?

Answer

N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt
N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-1) is a crystalline compound with a high molecular weight. It has a low solubility in water, making it ideal for applications requiring controlled dissolution. The compound is known for its stability and reactivity under mild conditions. It exhibits weak basic properties due to the presence of the potassium salt. This compound is often used in research and industrial applications where its unique chemical properties are advantageous.

About

CAS No 69416-61-1
English Name N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt
Molecular Formula C13H14KNO5
Molecular Weight 303.35 g/mol
SMILES CC(=CC(=O)OC)NC(C1=CC=C(C=C1)O)C(=O)[O-].[K+]
InChIKey HFDVONAPNRXRSV-USRGLUTNSA-M
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-1) typically synthesized?

N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-...

Compound Q&A

What industries use N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-1)?

N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-...

Compound Q&A

What precautions should be taken when handling N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (CAS: 69416-61-1)?

When handling N-(1-Methoxycarbonyl-1-propen-2-yl)-(aD)-amino-p-hydroxyphenylacetate Potassium Salt (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...