Compound Q&A

How should waste containing 2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6) be handled?

Answer

2,6-Difluorobenzenesulfonyl chloride
Waste containing 2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6) should be collected in appropriately labeled containers and disposed of through professional waste disposal services. Incineration or other safe chemical waste management methods should be employed to ensure environmental protection and compliance with local regulations.

About

CAS No 60230-36-6
English Name 2,6-Difluorobenzenesulfonyl chloride
Molecular Formula C6H3ClF2O2S
Molecular Weight 212.6 g/mol
SMILES C1=CC(=C(C(=C1)F)S(=O)(=O)Cl)F
InChIKey QXWAUQMMMIMLTO-UHFFFAOYSA-N
Last Updated: 2025-09-08 18:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6)?

2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6) is regulated under the Globally Harmonized Sy...

Compound Q&A

Are there alternatives to 2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6) in synthesis?

There are alternative reagents such as 2,4-Difluorobenzenesulfonyl chloride and trifluoromethylsulfo...

Compound Q&A

What is the market or research trend for 2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6)?

The research trend for 2,6-Difluorobenzenesulfonyl chloride (CAS: 60230-36-6) indicates increasing i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...