Compound Q&A

Are there alternatives to 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4) in synthesis?

Answer

3,4-Dichlorobenzoyl chloride
There are several alternatives to 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4) in synthesis, such as 2,4-Dichlorobenzoyl chloride and 3,5-Dichlorobenzoyl chloride, which offer similar functionalities. Other substitutes include benzoic acid derivatives or other chlorobenzoyl chlorides depending on the specific application and reactivity requirements.

About

CAS No 3024-72-4
English Name 3,4-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=CC(=C(C=C1C(=O)Cl)Cl)Cl
InChIKey VTXNOVCTHUBABW-UHFFFAOYSA-N
Last Updated: 2025-09-08 18:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4)?

3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4) is regulated under various guidelines such as the Glob...

Compound Q&A

What is the market or research trend for 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4)?

The market for 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4) is driven by its use in pharmaceuticals...

Compound Q&A

How should waste containing 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4) be handled?

Waste containing 3,4-Dichlorobenzoyl chloride (CAS: 3024-72-4) should be collected in appropriate co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...