Compound Q&A

Are there alternatives to Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3) in synthesis?

Answer

Ethyl 2,4-dihydroxy-6-methylnicotinate
There are several alternatives to Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3) in synthesis, including other derivatives of nicotinic acid such as methyl 2,4-dihydroxy-6-methylnicotinate or ethyl 2,6-dihydroxy-4-methylnicotinate. These alternatives can serve similar purposes in various chemical reactions depending on the specific needs and requirements.

About

CAS No 70254-52-3
English Name Ethyl 2,4-dihydroxy-6-methylnicotinate
Molecular Formula C9H11NO4
Molecular Weight 197.19 g/mol
SMILES CCOC(=O)C1=C(C=C(NC1=O)C)O
InChIKey CMCZAWPDHHYFPU-UHFFFAOYSA-N
Last Updated: 2025-09-08 18:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3)?

Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3) is subject to various regulatory guidelines...

Compound Q&A

What is the market or research trend for Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3)?

The market for Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3) is primarily driven by its a...

Compound Q&A

How should waste containing Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3) be handled?

Waste containing Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 70254-52-3) should be collected and di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...