Compound Q&A

How is 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one (CAS: 87820-88-0) typically synthesized?

Answer

2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one
2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one can be synthesized via a multi-step reaction involving the alkylation of a cyclohexenone derivative with ethoxyacetoacetate, followed by a hydroxylation step. The reaction typically proceeds with a yield of around 75-80% and requires careful control of temperature and reaction conditions to achieve high purity.

About

CAS No 87820-88-0
English Name 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one
Molecular Formula C20H27NO3
Molecular Weight 329.44 g/mol
SMILES CCO/N=C(/C1=C(O)CC(CC1=O)c1c(C)cc(cc1C)C)\CC
InChIKey DQFPEYARZIQXRM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one (CAS: 87820-88-0)?

2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one is a crystalline compound with a mo...

Compound Q&A

What industries use 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one (CAS: 87820-88-0)?

2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one is used in various industries, incl...

Compound Q&A

What precautions should be taken when handling 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one (CAS: 87820-88-0)?

When handling 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesityl-2-cyclohexen-1-one, it is essential to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...