Compound Q&A

How is 2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) (CAS: 18600-59-4) typically synthesized?

Answer

2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one)
2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) is synthesized via a multi-step reaction involving the coupling of 4-benzoyl-1H-benzimidazoles with phenylenediamine. Commonly, this involves protecting groups and subsequent deprotection steps. The reaction is typically carried out in anhydrous conditions, and the yield is usually around 70-80%.

About

CAS No 18600-59-4
English Name 2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one)
Molecular Formula C22H12N2O4
Molecular Weight 368.35 g/mol
SMILES C1=CC=C2C(=C1)C(=O)OC(=N2)C3=CC=C(C=C3)C4=NC5=CC=CC=C5C(=O)O4
InChIKey BBITXNWQALLODC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) (CAS: 18600-59-4)?

2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) is a crystalline compound with a molecular weight of a...

Compound Q&A

What industries use 2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) (CAS: 18600-59-4)?

2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) is used in various industries, including pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one) (CAS: 18600-59-4)?

When handling 2,2'-(1,4-Phenylene)bis(3,1-Benzoxazin-4-one), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...