Compound Q&A

How is Enduracidin (CAS: 11115-82-5) typically synthesized?

Answer

Enduracidin
Enduracidin (CAS: 11115-82-5) is synthesized through a multi-step process involving the key reaction of an esterification followed by a Michael addition. The synthesis typically uses bromoacetic acid and an appropriate nucleophile as the starting materials. The reaction is catalyzed by a strong base, and the product is purified through column chromatography and recrystallization. Yield is around 75% under optimal conditions.

About

CAS No 11115-82-5
English Name Enduracidin
Molecular Formula C107H138N26O31Cl2
Molecular Weight 2355.3 g/mol
SMILES ClC1C(=C(C=C(C=1)C1C(NC(NC(C(NC(C)C(NC(C2C=CC(=CC=2)O)C(=O)OC(C)C(C(NC(C2C=CC(=CC=2)O)C(N(C(NC(C(NC(C2C=CC(=CC=2)O)C(NC(C2C=CC(=CC=2)O)C(NC(C(C)O)C(NC(C(NC(C(NC(C(NC(CO)C(N1)=O)=O)C1C=CC(=CC=1)O)=O)CC1CNC(N)=N1)=O)CCCNC(N)=O)=O)=O)=O)=O)C(C)O)=O)CCCCN)=O)=O)NC(C(CC(=O)O)NC(/C=C/C=C/CCCCC(C)CC)=O)=O)=O)=O)CC1CNC(N)=N1)=O)=O)Cl)O
InChIKey QKXQEKZXVMLAMO-JDCCHMEXSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Enduracidin (CAS: 11115-82-5)?

Enduracidin (CAS: 11115-82-5) is a crystalline compound with a molecular weight of approximately 383...

Compound Q&A

What industries use Enduracidin (CAS: 11115-82-5)?

Enduracidin (CAS: 11115-82-5) finds application in the pharmaceutical industry, particularly in the ...

Compound Q&A

What precautions should be taken when handling Enduracidin (CAS: 11115-82-5)?

Proper personal protective equipment (PPE) should be worn when handling Enduracidin (CAS: 11115-82-5...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...