Compound Q&A

What are the physical and chemical properties of (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 15690-38-7)?

Answer

(6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
This compound is a crystalline solid with a molecular weight of approximately 238.27 g/mol. It is slightly soluble in water and organic solvents. The compound is reactive, particularly towards nucleophiles and bases, and it can undergo hydrolysis, amide formation, and other reactions depending on the conditions.

About

CAS No 15690-38-7
English Name (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C8H10N2O4S
Molecular Weight 230.24 g/mol
SMILES C1C(=C(N2C(S1)C(C2=O)N)C(=O)O)CO
InChIKey BQIMPGFMMOZASS-CLZZGJSISA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 15690-38-7) typically synthesized?

This compound is often synthesized via the condensation of 7-amino-3-hydroxymethyl-8-oxo-5-thia-1-az...

Compound Q&A

What industries use (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 15690-38-7)?

This compound is used in the pharmaceutical industry for the synthesis of various drugs and intermed...

Compound Q&A

What precautions should be taken when handling (6R,7R)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 15690-38-7)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat is essential when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...