Compound Q&A

What are the physical and chemical properties of 3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0)?

Answer

3-(Triethoxysilyl)propyl methacrylate
3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0) is a colorless to light yellow viscous liquid. It has a molecular weight of approximately 314.4 g/mol and is poorly soluble in water but miscible with organic solvents. It exhibits good reactivity, particularly towards silanes, making it useful in coupling applications.

About

CAS No 21142-29-0
English Name 3-(Triethoxysilyl)propyl methacrylate
Molecular Formula C13H26O5Si
Molecular Weight 290.43 g/mol
SMILES CCO[Si](CCCOC(=O)C(=C)C)(OCC)OCC
InChIKey URDOJQUSEUXVRP-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0) typically synthesized?

3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0) is typically synthesized by the reaction of ...

Compound Q&A

What industries use 3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0)?

3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0) is widely used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0)?

When handling 3-(Triethoxysilyl)propyl methacrylate (CAS: 21142-29-0), proper personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...