Compound Q&A

What are the physical and chemical properties of 3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0)?

Answer

3,8-Dibromo-1,10-phenanthroline
3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0) is a dark red crystalline solid with a molecular weight of 336.04 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is highly stable but can react with reducing agents and oxidizing agents, showing weak basicity. It is often used as a coordination compound in various chemical reactions due to its ability to form complexes with transition metals.

About

English Name 3,8-Dibromo-1,10-phenanthroline
Molecular Formula C12H6Br2N2
Molecular Weight 338 g/mol
SMILES C1=CC2=CC(=CN=C2C3=NC=C(C=C31)Br)Br
InChIKey IDWJREBUVYSPKS-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0) typically synthesized?

3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0) is typically synthesized by bromination of 1,10-p...

Compound Q&A

What industries use 3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0)?

3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0) is used in various industries including pharmaceu...

Compound Q&A

What precautions should be taken when handling 3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0)?

When handling 3,8-Dibromo-1,10-phenanthroline (CAS: 100125-12-0), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...