Compound Q&A

What industries use Acetate, 2-amino-, calcium salt (2:1) (CAS: 35947-07-0)?

Answer

Acetate, 2-amino-, calcium salt (2:1)
Acetate, 2-amino-, calcium salt (2:1) is used in pharmaceuticals for its buffering and chelating properties, in the synthesis of organic compounds, and as a reagent in analytical chemistry and environmental analysis. It is also utilized in the production of certain polymers and as a component in sensors.

About

CAS No 35947-07-0
English Name Acetate, 2-amino-, calcium salt (2:1)
Molecular Formula C4H8CaN2O4
Molecular Weight 190.21 g/mol
SMILES C(C(=O)[O-])N.C(C(=O)[O-])N.[CaH2]
InChIKey NIFIHZMTHYEXTG-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetate, 2-amino-, calcium salt (2:1) (CAS: 35947-07-0)?

Acetate, 2-amino-, calcium salt (2:1) is a white powder with a molecular weight of approximately 243...

Compound Q&A

How is Acetate, 2-amino-, calcium salt (2:1) (CAS: 35947-07-0) typically synthesized?

Acetate, 2-amino-, calcium salt (2:1) is typically synthesized by the reaction of calcium acetate wi...

Compound Q&A

What precautions should be taken when handling Acetate, 2-amino-, calcium salt (2:1) (CAS: 35947-07-0)?

When handling Acetate, 2-amino-, calcium salt (2:1), it is important to wear personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...