Compound Q&A

How is N-(2,5-Dichlorobenzoyl)glycine (CAS: 667403-46-5) typically synthesized?

Answer

N-(2,5-Dichlorobenzoyl)glycine
N-(2,5-Dichlorobenzoyl)glycine is typically synthesized through the coupling reaction of 2,5-dichlorobenzoyl chloride with glycine. This reaction is catalyzed by a Lewis acid such as aluminum chloride and proceeds under anhydrous conditions. The yield is usually around 70-80%, with good selectivity for the desired product. The reaction can be carried out in an appropriate solvent such as dichloromethane or acetonitrile.

About

English Name N-(2,5-Dichlorobenzoyl)glycine
Molecular Formula C9H7Cl2NO3
Molecular Weight 248.06 g/mol
SMILES C1=CC(=C(C=C1Cl)C(=O)NCC(=O)O)Cl
InChIKey HKUAUZSWGMQPOK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(2,5-Dichlorobenzoyl)glycine (CAS: 667403-46-5)?

N-(2,5-Dichlorobenzoyl)glycine is a white to off-white solid with a crystalline form. Its molecular ...

Compound Q&A

What industries use N-(2,5-Dichlorobenzoyl)glycine (CAS: 667403-46-5)?

N-(2,5-Dichlorobenzoyl)glycine is used in various industries. It is a key intermediate in the synthe...

Compound Q&A

What precautions should be taken when handling N-(2,5-Dichlorobenzoyl)glycine (CAS: 667403-46-5)?

When handling N-(2,5-Dichlorobenzoyl)glycine, it is important to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...