Compound Q&A

How is 1,1'-Sulfonylbis(1H-imidazole) (CAS: 7189-69-7) typically synthesized?

Answer

1,1'-Sulfonylbis(1H-imidazole)
1,1'-Sulfonylbis(1H-imidazole) is typically synthesized through the reaction of two equivalents of imidazole with sulfonyl chloride, catalyzed by a suitable base such as triethylamine. The reaction proceeds via an imidazole dimerization followed by sulfonation. The yield is usually around 85%, and the product is isolated by recrystallization from ethanol.

About

CAS No 7189-69-7
English Name 1,1'-Sulfonylbis(1H-imidazole)
Molecular Formula C6H6N4O2S
Molecular Weight 198.20700000000002 g/mol
SMILES C1=CN(C=N1)S(=O)(=O)N2C=CN=C2
InChIKey ZLKNPIVTWNMMMH-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-Sulfonylbis(1H-imidazole) (CAS: 7189-69-7)?

1,1'-Sulfonylbis(1H-imidazole) is a crystalline solid with a molecular weight of approximately 222.2...

Compound Q&A

What industries use 1,1'-Sulfonylbis(1H-imidazole) (CAS: 7189-69-7)?

1,1'-Sulfonylbis(1H-imidazole) finds applications in the pharmaceutical industry as a precursor in t...

Compound Q&A

What precautions should be taken when handling 1,1'-Sulfonylbis(1H-imidazole) (CAS: 7189-69-7)?

Proper personal protective equipment (PPE) must be worn when handling 1,1'-Sulfonylbis(1H-imidazole)...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...