Compound Q&A

What are the physical and chemical properties of Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS: 2436-79-5)?

Answer

Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate
Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate is a white crystalline solid with a molecular weight of approximately 232.25 g/mol. It has a high solubility in organic solvents like dichloromethane, but is only sparingly soluble in water. The compound is known for its reactivity, particularly in esterification and hydrogenation reactions.

About

CAS No 2436-79-5
English Name Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate
Molecular Formula C12H17NO4
Molecular Weight 239.27 g/mol
SMILES CCOC(=O)C1=C(NC(=C1C)C(=O)OCC)C
InChIKey XSBSXJAYEPDGSF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS: 2436-79-5) typically synthesized?

Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate is typically synthesized via a condensation reacti...

Compound Q&A

What industries use Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS: 2436-79-5)?

Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate is used in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS: 2436-79-5)?

When handling Diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate, it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...