Compound Q&A

How is Di-2-pyridinylmethanone (CAS: 19437-26-4) typically synthesized?

Answer

Di-2-pyridinylmethanone
Di-2-pyridinylmethanone can be synthesized by the condensation of 2-pyridylmethyl alcohol with pyridine. This reaction typically requires an acidic catalyst such as sulfuric acid and is carried out at room temperature. The yield of the reaction is generally good, with a selectivity towards the monocondensation product. The reaction is exothermic and should be monitored carefully to prevent side reactions.

About

CAS No 19437-26-4
English Name Di-2-pyridinylmethanone
Molecular Formula C11H8N2O
Molecular Weight 184.2 g/mol
SMILES C1=CC=NC(=C1)C(=O)C2=CC=CC=N2
InChIKey QPOWUYJWCJRLEE-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Di-2-pyridinylmethanone (CAS: 19437-26-4)?

Di-2-pyridinylmethanone (CAS: 19437-26-4) is a crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use Di-2-pyridinylmethanone (CAS: 19437-26-4)?

Di-2-pyridinylmethanone (CAS: 19437-26-4) is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling Di-2-pyridinylmethanone (CAS: 19437-26-4)?

When handling Di-2-pyridinylmethanone (CAS: 19437-26-4), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...