Compound Q&A

What precautions should be taken when handling 1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0)?

Answer

1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine
When handling 1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0), it is crucial to take appropriate safety measures to ensure laboratory and environmental safety. Always wear proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials and disposing of them according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed information on handling and emergency procedures.

About

CAS No 338-83-0
English Name 1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine
Molecular Formula C9F21N
Molecular Weight 521.06 g/mol
SMILES C(C(N(C(C(C(F)(F)F)(F)F)(F)F)C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(F)F
InChIKey JAJLKEVKNDUJBG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0)?

1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0) is a colorless, o...

Compound Q&A

How is 1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0) typically synthesized?

1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0) is synthesized th...

Compound Q&A

What industries use 1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0)?

1,1,2,2,3,3,3-Heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine (CAS: 338-83-0) is primarily used...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...