Compound Q&A

What precautions should be taken when handling 4,4'-(2,2-Butanediyl)diphenol (CAS: 77-40-7)?

Answer

4,4'-(2,2-Butanediyl)diphenol
When handling 4,4'-(2,2-Butanediyl)diphenol, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be used in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials, and proper disposal should be followed as per local regulations. Safety data sheets (SDS) should always be consulted for detailed safety information.

About

CAS No 77-40-7
English Name 4,4'-(2,2-Butanediyl)diphenol
Molecular Formula C16H18O2
Molecular Weight 242.31 g/mol
SMILES CCC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O
InChIKey HTVITOHKHWFJKO-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-(2,2-Butanediyl)diphenol (CAS: 77-40-7)?

4,4'-(2,2-Butanediyl)diphenol is a crystalline white powder with a molecular weight of approximately...

Compound Q&A

How is 4,4'-(2,2-Butanediyl)diphenol (CAS: 77-40-7) typically synthesized?

4,4'-(2,2-Butanediyl)diphenol is typically synthesized via a coupling reaction between phenol and 1,...

Compound Q&A

What industries use 4,4'-(2,2-Butanediyl)diphenol (CAS: 77-40-7)?

4,4'-(2,2-Butanediyl)diphenol finds applications in the pharmaceutical, polymer, and sensor industri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...