Compound Q&A

What industries use 1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3)?

Answer

1,4-Dioxacycloheptadecane-5,17-dione
1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3) is used in a variety of industries. It serves as a precursor in the pharmaceutical sector for the synthesis of certain biologically active compounds. In the polymer industry, it can be used in the development of novel materials. Additionally, it is utilized in the semiconductor industry for specific applications due to its chemical properties, and it has potential applications in sensor technology and other advanced materials.

About

CAS No 105-95-3
English Name 1,4-Dioxacycloheptadecane-5,17-dione
Molecular Formula C15H26O4
Molecular Weight 270.37 g/mol
SMILES C1CCCCCC(=O)OCCOC(=O)CCCCC1
InChIKey XRHCAGNSDHCHFJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3)?

1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3) is a colorless solid with a crystalline form. I...

Compound Q&A

How is 1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3) typically synthesized?

1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3) is typically synthesized through the cyclizatio...

Compound Q&A

What precautions should be taken when handling 1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3)?

When handling 1,4-Dioxacycloheptadecane-5,17-dione (CAS: 105-95-3), it is important to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...