Compound Q&A

What industries use (5-Chloro-2-phenoxyphenyl)acetic acid (CAS: 70958-20-2)?

Answer

(5-Chloro-2-phenoxyphenyl)acetic acid
(5-Chloro-2-phenoxyphenyl)acetic acid is primarily used in the pharmaceutical industry as an intermediate for drug synthesis. It is also used in the chemical industry for the production of various organic compounds and in the polymer industry for specific applications requiring aromatic functionalities.

About

CAS No 70958-20-2
English Name (5-Chloro-2-phenoxyphenyl)acetic acid
Molecular Formula C14H11ClO3
Molecular Weight 262.69 g/mol
SMILES C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)CC(=O)O
InChIKey PKMKNEIUKHPJAX-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Chloro-2-phenoxyphenyl)acetic acid (CAS: 70958-20-2)?

(5-Chloro-2-phenoxyphenyl)acetic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is (5-Chloro-2-phenoxyphenyl)acetic acid (CAS: 70958-20-2) typically synthesized?

(5-Chloro-2-phenoxyphenyl)acetic acid can be synthesized through a multistep process involving the c...

Compound Q&A

What precautions should be taken when handling (5-Chloro-2-phenoxyphenyl)acetic acid (CAS: 70958-20-2)?

When handling (5-Chloro-2-phenoxyphenyl)acetic acid, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...