Compound Q&A

What industries use D-Asparagine hydrate (CAS: 5794-24-1)?

Answer

D-Asparagine hydrate (1:1)
D-Asparagine hydrate (CAS: 5794-24-1) is used in various industries including pharmaceuticals, where it serves as a precursor for other amino acids and peptides. It is also utilized in the production of polymers and biodegradable materials. Additionally, it finds applications in the development of sensors and as a reagent in semiconductor manufacturing.

About

CAS No 5794-24-1
English Name D-Asparagine hydrate (1:1)
Molecular Formula C4H10N2O4
Molecular Weight 150.13 g/mol
SMILES N[C@H](CC(N)=O)C(O)=O.[H]O[H]
InChIKey RBMGJIZCEWRQES-HSHFZTNMSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of D-Asparagine hydrate (CAS: 5794-24-1)?

D-Asparagine hydrate (CAS: 5794-24-1) is a white crystalline powder. Its molecular weight is approxi...

Compound Q&A

How is D-Asparagine hydrate (CAS: 5794-24-1) typically synthesized?

D-Asparagine hydrate (CAS: 5794-24-1) is synthesized by the reaction of D-asparagine with water unde...

Compound Q&A

What precautions should be taken when handling D-Asparagine hydrate (CAS: 5794-24-1)?

When handling D-Asparagine hydrate (CAS: 5794-24-1), it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...