Compound Q&A

What are the physical and chemical properties of 1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) (CAS: 59831-02-6)?

Answer

1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1)
1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) is a crystalline compound with a molecular weight of approximately 646.5 g/mol. It has low solubility in water but is soluble in organic solvents like dichloromethane and ethanol. This compound is highly reactive and prone to hydrolysis under basic conditions. It is used as a catalyst in various organic reactions.

About

CAS No 59831-02-6
English Name 1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1)
Molecular Formula C27H26Cl2P2Pd
Molecular Weight 589.8 g/mol
SMILES C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Pd]Cl
InChIKey LDFBXJODFADZBN-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) (CAS: 59831-02-6) typically synthesized?

1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) is synthesized by the coupling of 1,...

Compound Q&A

What industries use 1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) (CAS: 59831-02-6)?

1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1) (CAS: 59831-02-6)?

When handling 1,3-Propanediylbis(diphenylphosphine) - dichloropalladium (1:1), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...