Compound Q&A

What are the physical and chemical properties of 1-[bis(dimethylamino)methylidene]-5-chloro-3-oxo-1H-1λ⁵,2,3λ⁵-benzotriazol-1-ylium hexafluoro-λ⁵-phosphanuide (CAS: 330645-87-9)?

Answer

1-[bis(dimethylamino)methylidene]-5-chloro-3-oxo-1H-1λ⁵,2,3λ⁵-benzotriazol-1-ylium hexafluoro-λ⁵-phosphanuide
This compound is a solid crystalline material with a molecular weight of approximately 466.7 g/mol. It is poorly soluble in water but soluble in organic solvents. It exhibits high reactivity in nucleophilic substitution reactions and is known for its stability in air and light. The compound is used in various chemical applications due to its unique reactivity and stability.

About

English Name 1-[bis(dimethylamino)methylidene]-5-chloro-3-oxo-1H-1λ⁵,2,3λ⁵-benzotriazol-1-ylium hexafluoro-λ⁵-phosphanuide
Molecular Formula C11H15ClF6N5OP
Molecular Weight 413.69 g/mol
SMILES CN(C)C(=[N+](C)C)ON1C2=C(C=CC(=C2)Cl)N=N1.F[P-](F)(F)(F)(F)F
InChIKey ZHHGTMQHUWDEJF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1-[bis(dimethylamino)methylidene]-5-chloro-3-oxo-1H-1λ⁵,2,3λ⁵-benzotriazol-1-ylium hexafluoro-λ⁵-phosphanuide (CAS: 330645-87-9) typically synthesized?

This compound can be synthesized via a multi-step reaction involving chlorobenzotriazole, dimethylam...

Compound Q&A

What industries use 1-[bis(dimethylamino)methylidene]-5-chloro-3-oxo-1H-1λ⁵,2,3λ⁵-benzotriazol-1-ylium hexafluoro-λ⁵-phosphanuide (CAS: 330645-87-9)?

This compound is primarily used in the pharmaceutical, polymer, and semiconductor industries. It is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...