Compound Q&A

What are the physical and chemical properties of 1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanol hydrochloride (CAS: 135261-74-4)?

Answer

1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanol hydrochloride (1:1)
This compound is a hygroscopic crystalline solid with a molecular weight of approximately 465.55 g/mol. It has a pKa of 2.4 and a solubility of about 100 mg/mL in water. Chemically, it shows reactivity towards bases and may undergo hydrolysis under basic conditions. It is also relatively stable under acidic conditions.

About

English Name 1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanol hydrochloride (1:1)
Molecular Formula C20H28ClNO3
Molecular Weight 365.9 g/mol
SMILES CN(C)CC(COC1=CC=CC=C1CCC2=CC(=CC=C2)OC)O.Cl
InChIKey YWZCEYHTWKUNMW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanol hydrochloride (CAS: 135261-74-4) typically synthesized?

This compound is typically synthesized via a multi-step process involving the coupling of an aryl ha...

Compound Q&A

What industries use 1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanol hydrochloride (CAS: 135261-74-4)?

This compound is used in the pharmaceutical industry for the synthesis of certain drug intermediates...

Compound Q&A

What precautions should be taken when handling 1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanol hydrochloride (CAS: 135261-74-4)?

Proper personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...