Compound Q&A

What precautions should be taken when handling nitric acid, platinum(2+) salt (CAS: 18496-40-7)?

Answer

Nitric acid, platinum(2+) salt
Proper handling of nitric acid, platinum(2+) salt requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a fume hood to minimize exposure. In case of spill, use appropriate spill response materials and refer to the Safety Data Sheet (SDS) for detailed instructions.

About

CAS No 18496-40-7
English Name Nitric acid, platinum(2+) salt
Molecular Formula N2O6Pt
Molecular Weight 319.09 g/mol
SMILES [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Pt+2]
InChIKey NWAHZABTSDUXMJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nitric acid, platinum(2+) salt (CAS: 18496-40-7)?

Nitric acid, platinum(2+) salt (CAS: 18496-40-7) is a crystalline solid with a high molecular weight...

Compound Q&A

How is nitric acid, platinum(2+) salt (CAS: 18496-40-7) typically synthesized?

Nitric acid, platinum(2+) salt is typically synthesized by dissolving platinum(II) salts in nitric a...

Compound Q&A

What industries use nitric acid, platinum(2+) salt (CAS: 18496-40-7)?

Nitric acid, platinum(2+) salt is used in various industries, including pharmaceuticals for catalyst...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...