Compound Q&A

What are the physical and chemical properties of (2-Nitrophenyl)acetic acid (CAS: 3740-52-1)?

Answer

(2-Nitrophenyl)acetic acid
(2-Nitrophenyl)acetic acid is a crystalline solid with a molecular weight of approximately 207.08 g/mol. It has a low solubility in water but good solubility in organic solvents. The compound is moderately reactive, particularly towards nucleophilic substitution reactions. It is commonly used in various chemical syntheses and as a reagent in analytical chemistry.

About

CAS No 3740-52-1
English Name (2-Nitrophenyl)acetic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES C1=CC=C(C(=C1)CC(=O)O)[N+](=O)[O-]
InChIKey WMUZDBZPDLHUMW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (2-Nitrophenyl)acetic acid (CAS: 3740-52-1) typically synthesized?

(2-Nitrophenyl)acetic acid can be synthesized by esterification of 2-nitrophenol with acetic anhydri...

Compound Q&A

What industries use (2-Nitrophenyl)acetic acid (CAS: 3740-52-1)?

(2-Nitrophenyl)acetic acid is primarily used in the pharmaceutical, polymer, and analytical chemistr...

Compound Q&A

What precautions should be taken when handling (2-Nitrophenyl)acetic acid (CAS: 3740-52-1)?

When handling (2-Nitrophenyl)acetic acid, it is important to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...