Compound Q&A

What industries use 2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8)?

Answer

2-Bromodibenzo[b,d]thiophene
2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8) is primarily used in the pharmaceutical industry for the synthesis of various drug candidates, particularly those targeting specific receptors. It also finds applications in the semiconductor industry due to its electronic properties, and in the development of new organic materials and polymers for electronic devices.

About

CAS No 22439-61-8
English Name 2-Bromodibenzo[b,d]thiophene
Molecular Formula C12H7BrS
Molecular Weight 263.159 g/mol
SMILES C1=CC=C2C(=C1)C3=C(S2)C=CC(=C3)Br
InChIKey IJICRIUYZZESMW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8)?

2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8) is a solid with a melting point of 108-110°C. Its mol...

Compound Q&A

How is 2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8) typically synthesized?

2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8) is commonly synthesized via bromination of dibenzo[b,...

Compound Q&A

What precautions should be taken when handling 2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8)?

When handling 2-Bromodibenzo[b,d]thiophene (CAS: 22439-61-8), it is important to wear appropriate pe...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...