Compound Q&A

What industries use 3-Phenoxybenzoic Acid (CAS: 3739-38-6)?

Answer

3-Phenoxybenzoic Acid
3-Phenoxybenzoic Acid (CAS: 3739-38-6) is used in the pharmaceutical industry as an intermediate for drug synthesis. It also has applications in the polymer industry, where it serves as a stabilizer. Additionally, it is utilized in the production of sensors and semiconductors due to its chemical reactivity.

About

CAS No 3739-38-6
English Name 3-Phenoxybenzoic Acid
Molecular Formula C13H10O3
Molecular Weight 214.22 g/mol
SMILES C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)O
InChIKey NXTDJHZGHOFSQG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Phenoxybenzoic Acid (CAS: 3739-38-6)?

3-Phenoxybenzoic Acid (CAS: 3739-38-6) is a solid with a crystalline form. It has a molecular weight...

Compound Q&A

How is 3-Phenoxybenzoic Acid (CAS: 3739-38-6) typically synthesized?

3-Phenoxybenzoic Acid can be synthesized through the esterification of phenoxybenzoic acid ethyl est...

Compound Q&A

What precautions should be taken when handling 3-Phenoxybenzoic Acid (CAS: 3739-38-6)?

When handling 3-Phenoxybenzoic Acid (CAS: 3739-38-6), appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...