Compound Q&A

What are the physical and chemical properties of Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate (CAS: 152628-01-8)?

Answer

Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate
Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate has a crystalline form with a molecular weight of approximately 312.33 g/mol. It is moderately soluble in common organic solvents like DMSO and ethanol. The compound is known for its reactivity, particularly towards nucleophilic aromatic substitution and ester hydrolysis.

About

English Name Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate
Molecular Formula C13H16N2O5
Molecular Weight 280.28 g/mol
EINECS 604-865-0
SMILES CCCC(=O)NC1=C(C=C(C=C1C)C(=O)OC)[N+](=O)[O-]
InChIKey IGCBUUTXGYCQAI-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate (CAS: 152628-01-8) typically synthesized?

Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate is synthesized through the amidation of methyl 3-me...

Compound Q&A

What industries use Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate (CAS: 152628-01-8)?

Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate is used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate (CAS: 152628-01-8)?

When handling Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate, it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...