Compound Q&A

How is 1'-(2-Methylalanyl-O-benzyl-D-seryl)-1-(methylsulfonyl)-1,2-dihydrospiro[indole-3,4'-piperidine] methanesulfonate (CAS: 159752-10-0) typically synthesized?

Answer

1'-(2-Methylalanyl-O-benzyl-D-seryl)-1-(methylsulfonyl)-1,2-dihydrospiro[indole-3,4'-piperidine] methanesulfonate (1:1)
This compound can be synthesized by reacting benzyl esters of D-seryl chlorides with 2-methylalanyl-O-benzyl chloride in the presence of a catalytic amount of a base such as triethylamine. The reaction is typically carried out in an anhydrous organic solvent like DMF or DCM. The product is isolated by column chromatography, and the methanesulfonate ester is formed by treating the product with methanesulfonyl chloride in the presence of a base like sodium hydride.

About

English Name 1'-(2-Methylalanyl-O-benzyl-D-seryl)-1-(methylsulfonyl)-1,2-dihydrospiro[indole-3,4'-piperidine] methanesulfonate (1:1)
Molecular Formula C28H40N4O8S2
Molecular Weight 624.78 g/mol
SMILES CC(C)(C(=O)N[C@H](COCc1ccccc1)C(=O)N2CCC3(CC2)CN(c4c3cccc4)S(=O)(=O)C)N.CS(=O)(=O)O
InChIKey DUGMCDWNXXFHDE-VZYDHVRKSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What industries use 1'-(2-Methylalanyl-O-benzyl-D-seryl)-1-(methylsulfonyl)-1,2-dihydrospiro[indole-3,4'-piperidine] methanesulfonate (CAS: 159752-10-0)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...