Compound Q&A

What are the physical and chemical properties of 2-Benzylaniline (CAS: 28059-64-5)?

Answer

2-Benzylaniline
2-Benzylaniline is a colorless to slightly yellow liquid with a molecular weight of approximately 154.22 g/mol. It has a melting point of -28°C and a boiling point of 184-186°C. The compound is moderately soluble in water but soluble in organic solvents like ethanol and acetone. It is moderately reactive, especially with strong acids and bases.

About

CAS No 28059-64-5
English Name 2-Benzylaniline
Molecular Formula C13H13N
Molecular Weight 183.25 g/mol
SMILES C1=CC=C(C=C1)CC2=CC=CC=C2N
InChIKey DWOBGCPUQNFAFB-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2-Benzylaniline (CAS: 28059-64-5) typically synthesized?

2-Benzylaniline is typically synthesized from aniline and benzoic acid through a condensation reacti...

Compound Q&A

What industries use 2-Benzylaniline (CAS: 28059-64-5)?

2-Benzylaniline is used in the pharmaceutical industry for the synthesis of certain medicinal compou...

Compound Q&A

What precautions should be taken when handling 2-Benzylaniline (CAS: 28059-64-5)?

When handling 2-Benzylaniline, it is important to wear appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...