Compound Q&A

What are the physical and chemical properties of 1,4-Benzenedisulfonate, 2-amino-, sodium salt (1:1) (CAS: 24605-36-5)?

Answer

1,4-Benzenedisulfonate, 2-amino-, sodium salt (1:1)
1,4-Benzenedisulfonate, 2-amino-, sodium salt (CAS: 24605-36-5) is a crystalline solid with a molecular weight of approximately 282.14 g/mol. It is highly soluble in water and less soluble in organic solvents. This compound is known for its reactivity, particularly in acid-base reactions and oxidation-reduction processes. It forms a stable crystalline structure and exhibits excellent solubility in polar solvents, making it suitable for various applications in industry.

About

CAS No 24605-36-5
English Name 1,4-Benzenedisulfonate, 2-amino-, sodium salt (1:1)
Molecular Formula C6H5NNaO6S2
Molecular Weight 275.2 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)[O-].[Na+]
InChIKey SYFQTIIOWUIZGU-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1,4-Benzenedisulfonate, 2-amino-, sodium salt (1:1) (CAS: 24605-36-5) typically synthesized?

1,4-Benzenedisulfonate, 2-amino-, sodium salt (CAS: 24605-36-5) can be synthesized by reacting 2-ami...

Compound Q&A

What industries use 1,4-Benzenedisulfonate, 2-amino-, sodium salt (1:1) (CAS: 24605-36-5)?

1,4-Benzenedisulfonate, 2-amino-, sodium salt (CAS: 24605-36-5) finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 1,4-Benzenedisulfonate, 2-amino-, sodium salt (1:1) (CAS: 24605-36-5)?

When handling 1,4-Benzenedisulfonate, 2-amino-, sodium salt (CAS: 24605-36-5), it is important to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...