Compound Q&A

How is Sodium 2-biphenylolate (CAS: 132-27-4) typically synthesized?

Answer

Sodium 2-biphenylolate
Sodium 2-biphenylolate can be synthesized by the condensation of 2-biphenylen-2-ol with sodium hydroxide. The reaction typically yields a high selectivity and high yield. This process requires careful control of temperature and pH to optimize the reaction conditions.

About

CAS No 132-27-4
English Name Sodium 2-biphenylolate
Molecular Formula C12H9NaO
Molecular Weight 192.19 g/mol
SMILES [O-]c1ccccc1c1ccccc1.[Na+]
InChIKey KSQXVLVXUFHGJQ-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 2-biphenylolate (CAS: 132-27-4)?

Sodium 2-biphenylolate (CAS: 132-27-4) is a crystalline compound with a molecular weight of approxim...

Compound Q&A

What industries use Sodium 2-biphenylolate (CAS: 132-27-4)?

Sodium 2-biphenylolate (CAS: 132-27-4) is primarily used in the pharmaceutical and chemical industri...

Compound Q&A

What precautions should be taken when handling Sodium 2-biphenylolate (CAS: 132-27-4)?

When handling Sodium 2-biphenylolate (CAS: 132-27-4), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...