Compound Q&A

What are the physical and chemical properties of (3beta)-3-Hydroxylup-20(29)-en-28-al (CAS: 13159-28-9)?

Answer

(3beta)-3-Hydroxylup-20(29)-en-28-al
(3beta)-3-Hydroxylup-20(29)-en-28-al is a yellow to orange crystalline solid with a molecular weight of approximately 416.67 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is known for its stability under neutral conditions but can be reactive towards strong oxidizing agents.

About

CAS No 13159-28-9
English Name (3beta)-3-Hydroxylup-20(29)-en-28-al
Molecular Formula C30H48O2
Molecular Weight 440.71 g/mol
SMILES CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C=O
InChIKey FELCJAPFJOPHSD-ROUWMTJPSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (3beta)-3-Hydroxylup-20(29)-en-28-al (CAS: 13159-28-9) typically synthesized?

(3beta)-3-Hydroxylup-20(29)-en-28-al can be synthesized via a total synthesis approach, involving ke...

Compound Q&A

What industries use (3beta)-3-Hydroxylup-20(29)-en-28-al (CAS: 13159-28-9)?

(3beta)-3-Hydroxylup-20(29)-en-28-al finds applications in the pharmaceutical industry, where it can...

Compound Q&A

What precautions should be taken when handling (3beta)-3-Hydroxylup-20(29)-en-28-al (CAS: 13159-28-9)?

When handling (3beta)-3-Hydroxylup-20(29)-en-28-al, it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...