Compound Q&A

What are the physical and chemical properties of (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid (CAS: 23680-31-1)?

Answer

(S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid
(S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid is a white crystalline solid with a molecular weight of approximately 340.47 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is reactive, particularly towards nucleophiles, and can undergo esterification and amidation reactions. It is often used in peptide synthesis due to its stability and reactivity.

About

CAS No 23680-31-1
English Name (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid
Molecular Formula C15H21NO5
Molecular Weight 295.34 g/mol
SMILES CC(C)(C)OC(=O)NC(COCC1=CC=CC=C1)C(=O)O
InChIKey DMBKPDOAQVGTST-LBPRGKRZSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid (CAS: 23680-31-1) typically synthesized?

(S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid is typically synthesized via a multi-...

Compound Q&A

What industries use (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid (CAS: 23680-31-1)?

(S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid (CAS: 23680-31-1)?

When handling (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid, it is important to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...