Compound Q&A

How is Methyl 6-bromo-2-naphthoate (CAS: 33626-98-1) typically synthesized?

Answer

Methyl 6-bromo-2-naphthoate
Methyl 6-bromo-2-naphthoate is commonly synthesized via the bromination of methyl 2-naphthoate. This involves treating methyl 2-naphthoate with bromine in the presence of a suitable catalyst such as N-bromosuccinimide (NBS). The reaction typically yields a high percentage of the target compound with good selectivity.

About

CAS No 33626-98-1
English Name Methyl 6-bromo-2-naphthoate
Molecular Formula C12H9BrO2
Molecular Weight 265.11 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)C=C(C=C2)Br
InChIKey JEUBRLPXJZOGPX-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-bromo-2-naphthoate (CAS: 33626-98-1)?

Methyl 6-bromo-2-naphthoate is a crystalline solid with a molecular weight of approximately 272.04 g...

Compound Q&A

What industries use Methyl 6-bromo-2-naphthoate (CAS: 33626-98-1)?

Methyl 6-bromo-2-naphthoate is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromo-2-naphthoate (CAS: 33626-98-1)?

When handling Methyl 6-bromo-2-naphthoate, it is important to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...