Compound Q&A

What are the physical and chemical properties of Adapalene Impurity 1 (CAS: 104224-63-7)?

Answer

Adapalene Impurity 1
Adapalene Impurity 1 is a yellow to orange crystalline solid with a molecular weight of approximately 273.36 g/mol. It has a melting point of about 76-80°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is reactive towards strong acids and bases, and forms stable complexes with transition metals.

About

English Name Adapalene Impurity 1
Molecular Formula C17H21BrO
Molecular Weight 321.26 g/mol
SMILES COC1=C(C=C(C=C1)Br)C23CC4CC(C2)CC(C4)C3
InChIKey QQAMHHZQONQBFZ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Adapalene Impurity 1 (CAS: 104224-63-7) typically synthesized?

Adapalene Impurity 1 is typically synthesized through a multistep process involving the condensation...

Compound Q&A

What industries use Adapalene Impurity 1 (CAS: 104224-63-7)?

Adapalene Impurity 1 is primarily used in the pharmaceutical industry for quality control and impuri...

Compound Q&A

What precautions should be taken when handling Adapalene Impurity 1 (CAS: 104224-63-7)?

When handling Adapalene Impurity 1, it is essential to wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...