Compound Q&A

How is 1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid (CAS: 116-81-4) typically synthesized?

Answer

1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid
This compound is typically synthesized through the bromination of anthraquinone followed by sulfonation and amidation reactions. Common catalysts include sulfuric acid and sodium hydroxide. The process yields a high purity product with good selectivity and yield.

About

CAS No 116-81-4
English Name 1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid
Molecular Formula C14H8BrNO5S
Molecular Weight 382.19 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C=C(C(=C3C2=O)N)S(=O)(=O)O)Br
InChIKey QZZSAWGVHXXMID-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid (CAS: 116-81-4)?

1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid is a crystalline solid with a high...

Compound Q&A

What industries use 1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid (CAS: 116-81-4)?

1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid is used in pharmaceuticals for dye...

Compound Q&A

What precautions should be taken when handling 1-Amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid (CAS: 116-81-4)?

When handling this compound, proper personal protective equipment (PPE) including gloves, goggles, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...