Compound Q&A

What precautions should be taken when handling FAAH-IN-2 (CAS: 184475-71-6)?

Answer

FAAH-IN-2
When handling FAAH-IN-2 (CAS: 184475-71-6), appropriate Personal Protective Equipment (PPE) such as gloves and safety goggles should be worn. It should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, use appropriate spill cleanup procedures as outlined in the Safety Data Sheet (SDS). Always ensure the area is well-ventilated and use a fume hood when necessary to minimize exposure to the compound.

About

English Name FAAH-IN-2
Molecular Formula C15H11ClFN3O2
Molecular Weight 319.72 g/mol
SMILES COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)O
InChIKey JLVTVCRXFMLUIF-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of FAAH-IN-2 (CAS: 184475-71-6)?

FAAH-IN-2 (CAS: 184475-71-6) is a crystalline compound with a molecular weight of approximately 411....

Compound Q&A

How is FAAH-IN-2 (CAS: 184475-71-6) typically synthesized?

FAAH-IN-2 (CAS: 184475-71-6) is synthesized through a multi-step process involving the protection of...

Compound Q&A

What industries use FAAH-IN-2 (CAS: 184475-71-6)?

FAAH-IN-2 (CAS: 184475-71-6) is primarily used in the pharmaceutical industry for the development of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...