Compound Q&A

What are the physical and chemical properties of 2,2'-Biquinoline (CAS: 119-91-5)?

Answer

2,2'-Biquinoline
2,2'-Biquinoline is a yellow crystalline solid with a molecular weight of approximately 232.2 g/mol. It has a relatively low solubility in water but is soluble in common organic solvents like ethanol and methanol. Chemically, it is known for its good electron donor properties, making it useful in various redox reactions. It is also slightly basic due to its quinoline rings.

About

CAS No 119-91-5
English Name 2,2'-Biquinoline
Molecular Formula C18H12N2
Molecular Weight 256.31 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=N2)C3=NC4=CC=CC=C4C=C3
InChIKey WPTCSQBWLUUYDV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 2,2'-Biquinoline (CAS: 119-91-5) typically synthesized?

2,2'-Biquinoline is commonly synthesized by the condensation of 2,4-dinitroquinoline with 2,4-dinitr...

Compound Q&A

What industries use 2,2'-Biquinoline (CAS: 119-91-5)?

2,2'-Biquinoline finds applications in various industries. It is used in the pharmaceutical sector f...

Compound Q&A

What precautions should be taken when handling 2,2'-Biquinoline (CAS: 119-91-5)?

When handling 2,2'-Biquinoline, it is important to use appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...