Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate (CAS: 1153949-11-1)?

Answer

2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate
2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate is a crystalline compound with a molecular weight of approximately 204.24 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. The compound exhibits moderate reactivity, particularly towards nucleophiles and reducing agents. It is stable under normal laboratory conditions but should be stored in a cool, dry place to prevent degradation.

About

English Name 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate
Molecular Formula C10H14N2O2
Molecular Weight 194.23 g/mol
SMILES CC(C)(C)OC(=O)N1CC(=CC#N)C1
InChIKey BESFCRTTXQYNBW-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate (CAS: 1153949-11-1) typically synthesized?

2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate is typically synthesized via a multi-s...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate (CAS: 1153949-11-1)?

2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate (CAS: 1153949-11-1)?

When handling 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate, it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...