Compound Q&A

What are the physical and chemical properties of Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9)?

Answer

Sodium 4-butylnaphthalene-1-sulfonate
Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9) is a crystalline solid with a molecular weight of approximately 264.27 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is relatively stable under normal conditions but can react with strong acids. It is often used in various applications due to its chemical stability and solubility properties.

About

CAS No 25638-17-9
English Name Sodium 4-butylnaphthalene-1-sulfonate
Molecular Formula C14H15NaO3S
Molecular Weight 286.32 g/mol
SMILES CCCCc1ccc(c2c1cccc2)S(=O)(=O)[O-].[Na+]
InChIKey AGVNDXHAPPQIMH-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9) typically synthesized?

Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9) is synthesized through the sulfonation of 4-...

Compound Q&A

What industries use Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9)?

Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9) finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9)?

When handling Sodium 4-butylnaphthalene-1-sulfonate (CAS: 25638-17-9), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...