Compound Q&A

What industries use Quillaic acid (CAS: 631-01-6)?

Answer

Quillaic acid
Quillaic acid is utilized in the pharmaceutical industry for the synthesis of certain drugs, particularly in the modification of biomolecules. It is also used in polymer chemistry for the production of specialized polymers with tailored properties. Additionally, it has applications in sensors for detecting specific chemicals and in the development of semiconductors.

About

CAS No 631-01-6
English Name Quillaic acid
Molecular Formula C30H46O5
Molecular Weight 486.68 g/mol
SMILES O=C[C@]1(C)[C@@H](O)CC[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@@H](O)[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C
InChIKey MQUFAARYGOUYEV-UAWZMHPWSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Quillaic acid (CAS: 631-01-6)?

Quillaic acid (CAS: 631-01-6) is a white crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is Quillaic acid (CAS: 631-01-6) typically synthesized?

Quillaic acid is usually synthesized via a multi-step process involving the condensation of 2-oxobut...

Compound Q&A

What precautions should be taken when handling Quillaic acid (CAS: 631-01-6)?

When handling Quillaic acid (CAS: 631-01-6), it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...