Compound Q&A

What industries use 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5)?

Answer

2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5) finds application in the pharmaceutical industry, particularly in the synthesis of certain APIs and intermediates. Its structural features make it useful for developing novel drugs. Additionally, it may be used in the production of polymers and as a reagent in analytical chemistry and sensor technology due to its reactivity and specific functional groups.

About

English Name 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Molecular Formula C17H21NO5
Molecular Weight 319.36 g/mol
SMILES CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OCc2ccccc2
InChIKey TZNBTMCEMLXYEM-ZDUSSCGKSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5)?

2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5) is a cry...

Compound Q&A

How is 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5) typically synthesized?

2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5) can be s...

Compound Q&A

What precautions should be taken when handling 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-36-5)?

When handling 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate (CAS: 113400-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...