Compound Q&A

What are the physical and chemical properties of Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0)?

Answer

Tetrabutylammonium dihydrogenphosphate
Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0) is a white crystalline powder with a molecular weight of approximately 292.4 g/mol. It is sparingly soluble in water and ethanol but readily soluble in organic solvents like dimethylformamide. The compound is relatively stable but can react with strong bases to form tetrabutylammonium salts. It is often used in buffer solutions and as a stabilizer in various applications.

About

CAS No 5574-97-0
English Name Tetrabutylammonium dihydrogenphosphate
Molecular Formula C16H38NO4P
Molecular Weight 339.45 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.OP(=O)(O)[O-]
InChIKey ARRNBPCNZJXHRJ-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0) typically synthesized?

Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0) is typically synthesized by reacting tetrabu...

Compound Q&A

What industries use Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0)?

Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0) is widely used in pharmaceuticals, where it ...

Compound Q&A

What precautions should be taken when handling Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0)?

When handling Tetrabutylammonium dihydrogenphosphate (CAS: 5574-97-0), it is essential to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...