Compound Q&A

What industries use 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1)?

Answer

1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one
1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1) is utilized in various industries. It is commonly employed in the pharmaceutical sector for the synthesis of certain drugs, in the semiconductor industry for its use in organic light-emitting diodes (OLEDs), and in the polymer industry as a monomer for the production of specific polymers. Additionally, it finds applications in sensor technology due to its unique optical properties.

About

CAS No 27387-31-1
English Name 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one
Molecular Formula C13H13NO
Molecular Weight 199.25300000000001 g/mol
SMILES CN1C2=C(C(=O)CCC2)C3=CC=CC=C31
InChIKey HHJUJCWZKJMCLC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1)?

1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1) is a crystalline solid with a molecu...

Compound Q&A

How is 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1) typically synthesized?

1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one is typically synthesized via the reaction of 2,3,4,9-t...

Compound Q&A

What precautions should be taken when handling 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1)?

When handling 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one (CAS: 27387-31-1), it is essential to we...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...