Compound Q&A

How is Vonoprazan Fumarate (CAS: 881681-01-2) typically synthesized?

Answer

Vonoprazan Fumarate
Vonoprazan Fumarate is synthesized through a multi-step process involving protection, functional group conversion, coupling, and desilylation. The synthesis typically uses mild conditions and a variety of reagents such as N-hydroxysuccinimide and dicyclohexylcarbodiimide. The overall yield is around 70%.

About

English Name Vonoprazan Fumarate
Molecular Formula C21H20FN3O6S
Molecular Weight 461.47 g/mol
SMILES CNCC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3.C(=CC(=O)O)C(=O)O
InChIKey ROGSHYHKHPCCJW-WLHGVMLRSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vonoprazan Fumarate (CAS: 881681-01-2)?

Vonoprazan Fumarate is a solid compound with a crystalline form. Its molecular weight is approximate...

Compound Q&A

What industries use Vonoprazan Fumarate (CAS: 881681-01-2)?

Vonoprazan Fumarate is primarily used in the pharmaceutical industry. It is an active ingredient in ...

Compound Q&A

What precautions should be taken when handling Vonoprazan Fumarate (CAS: 881681-01-2)?

When handling Vonoprazan Fumarate, appropriate personal protective equipment (PPE) such as gloves an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...