Compound Q&A

What are the physical and chemical properties of Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4)?

Answer

Zinc di(2-pyridinecarboxylate)
Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4) is a colorless or white crystalline solid with a high molecular weight and good solubility in organic solvents. It is moderately reactive and can form coordination complexes, making it suitable for various applications in pharmaceuticals and sensors. Its stability and reactivity make it a valuable compound in analytical chemistry and materials science.

About

CAS No 17949-65-4
English Name Zinc di(2-pyridinecarboxylate)
Molecular Formula C12H8N2O4Zn
Molecular Weight 309.58 g/mol
SMILES c1ccnc(c1)C(=O)[O-].c1ccnc(c1)C(=O)[O-].[Zn+2]
InChIKey NHVUUBRKFZWXRN-UHFFFAOYSA-L
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4) typically synthesized?

Zinc di(2-pyridinecarboxylate) is typically synthesized by reacting zinc acetate or zinc sulfate wit...

Compound Q&A

What industries use Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4)?

Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4) is used in pharmaceuticals for its chelating proper...

Compound Q&A

What precautions should be taken when handling Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4)?

When handling Zinc di(2-pyridinecarboxylate) (CAS: 17949-65-4), wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...